| Name | 4-Pyridinecarboxylic acid, 3-iodo- |
| Synonyms | 3-IODOISONICOTINIC ACID 3-iodo-4-pyridinecarboxylicaci 3-IODOPYRIDINE-4-CARBOXYLIC ACID 3-Iodo-4-pyridinecarboxylic acid 4-Pyridinecarboxylic acid, 3-iodo- |
| CAS | 57842-10-1 |
| InChI | InChI=1/C6H4INO2/c7-5-3-8-2-1-4(5)6(9)10/h1-3H,(H,9,10) |
| Molecular Formula | C6H4INO2 |
| Molar Mass | 249.01 |
| Density | 2.123g/cm3 |
| Melting Point | 205-210°C |
| Boling Point | 435.7°C at 760 mmHg |
| Flash Point | 217.3°C |
| Vapor Presure | 2.31E-08mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.677 |
| Physical and Chemical Properties | Chemical properties crystallization. Melting point 253 ℃. |
| Use | Uses intermediates of naphthyridine. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| customs code | 29333990 |
| storage conditions | Sealed in dry,2-8°C |
| morphology | Powder |
| color | Off-white to beige |